C20H31ClF2N2O4 — CID 156753312
tert-butyl 4-(5-chloro-2,3-difluoro-4-methylbenzoyl)piperazine-1-carboxylate;ethane;methanol (PubChem CID 156753312) has the molecular formula C20H31ClF2N2O4 and a molecular weight of 436.93 g/mol. Its IUPAC name is tert-butyl 4-(5-chloro-2,3-difluoro-4-methylbenzoyl)piperazine-1-carboxylate;ethane;methanol.
| Compound Name | tert-butyl 4-(5-chloro-2,3-difluoro-4-methylbenzoyl)piperazine-1-carboxylate;ethane;methanol |
|---|---|
| PubChem CID | 156753312 |
| Molecular Formula | C20H31ClF2N2O4 |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | tert-butyl 4-(5-chloro-2,3-difluoro-4-methylbenzoyl)piperazine-1-carboxylate;ethane;methanol |
| SMILES | CC.CO.Cc1c(Cl)cc(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2)c(F)c1F |
| InChI | InChI=1S/C17H21ClF2N2O3.C2H6.CH4O/c1-10-12(18)9-11(14(20)13(10)19)15(23)21-5-7-22(8-6-21)16(24)25-17(2,3)4;2*1-2/h9H,5-8H2,1-4H3;1-2H3;2H,1H3 |
| InChIKey | BCEWJTRSEHFHGI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|