C17H21N3O6 — CID 170729636
tert-butyl 4-(6-nitro-1-oxo-3H-2-benzofuran-5-yl)piperazine-1-carboxylate (PubChem CID 170729636) has the molecular formula C17H21N3O6 and a molecular weight of 363.37 g/mol. Its IUPAC name is tert-butyl 4-(6-nitro-1-oxo-3H-2-benzofuran-5-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-nitro-1-oxo-3H-2-benzofuran-5-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170729636 |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | tert-butyl 4-(6-nitro-1-oxo-3H-2-benzofuran-5-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc3c(cc2[N+](=O)[O-])C(=O)OC3)CC1 |
| InChI | InChI=1S/C17H21N3O6/c1-17(2,3)26-16(22)19-6-4-18(5-7-19)13-8-11-10-25-15(21)12(11)9-14(13)20(23)24/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | DGFAACZEYAQFSG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|