C15H22N4O8S — CID 143233368
tert-butyl pyrrolidine-1-carboxylate;2,4-dinitrobenzenesulfonamide (PubChem CID 143233368) has the molecular formula C15H22N4O8S and a molecular weight of 418.43 g/mol. Its IUPAC name is tert-butyl pyrrolidine-1-carboxylate;2,4-dinitrobenzenesulfonamide.
| Compound Name | tert-butyl pyrrolidine-1-carboxylate;2,4-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 143233368 |
| Molecular Formula | C15H22N4O8S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | tert-butyl pyrrolidine-1-carboxylate;2,4-dinitrobenzenesulfonamide |
| SMILES | CC(C)(C)OC(=O)N1CCCC1.NS(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H17NO2.C6H5N3O6S/c1-9(2,3)12-8(11)10-6-4-5-7-10;7-16(14,15)6-2-1-4(8(10)11)3-5(6)9(12)13/h4-7H2,1-3H3;1-3H,(H2,7,14,15) |
| InChIKey | YDIYTJWPRKQPPP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 175.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|