About tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol
tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol (PubChem CID 145268921) has the molecular formula C16H21F3N2O5
and a molecular weight of 378.35 g/mol. Its IUPAC name is tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol.
Molecular Properties
| Compound Name | tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol |
| PubChem CID | 145268921 |
| Molecular Formula | C16H21F3N2O5 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol |
| SMILES | CC(C)(C)OC(=O)N1CCCC1.O=[N+]([O-])c1cc(C(F)(F)F)ccc1O |
| InChI | InChI=1S/C9H17NO2.C7H4F3NO3/c1-9(2,3)12-8(11)10-6-4-5-7-10;8-7(9,10)4-1-2-6(12)5(3-4)11(13)14/h4-7H2,1-3H3;1-3,12H |
| InChIKey | CDLNSJXOSXAGJM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol?
The IUPAC name of tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol (CID 145268921) is tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol.
What is the SMILES notation for tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol?
The canonical SMILES for tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol is CC(C)(C)OC(=O)N1CCCC1.O=[N+]([O-])c1cc(C(F)(F)F)ccc1O.
What is the InChIKey of tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol?
The InChIKey is CDLNSJXOSXAGJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C7H4F3NO3/c1-9(2,3)12-8(11)10-6-4-5-7-10;8-7(9,10)4-1-2-6(12)5(3-4)11(13)14/h4-7H2,1-3H3;1-3,12H.
What are the key properties of tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol?
tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol has a molecular weight of 378.35 g/mol, XLogP of 4.34, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl pyrrolidine-1-carboxylate;2-nitro-4-(trifluoromethyl)phenol is sourced from PubChem (CID 145268921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).