C17H23FN4O4 — CID 166472130
tert-butyl 7-(3-fluoro-5-nitro-2-pyridinyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate (PubChem CID 166472130) has the molecular formula C17H23FN4O4 and a molecular weight of 366.39 g/mol. Its IUPAC name is tert-butyl 7-(3-fluoro-5-nitro-2-pyridinyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate.
| Compound Name | tert-butyl 7-(3-fluoro-5-nitro-2-pyridinyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate |
|---|---|
| PubChem CID | 166472130 |
| Molecular Formula | C17H23FN4O4 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | tert-butyl 7-(3-fluoro-5-nitro-2-pyridinyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCN(c3ncc([N+](=O)[O-])cc3F)CC2)C1 |
| InChI | InChI=1S/C17H23FN4O4/c1-16(2,3)26-15(23)21-10-17(11-21)4-6-20(7-5-17)14-13(18)8-12(9-19-14)22(24)25/h8-9H,4-7,10-11H2,1-3H3 |
| InChIKey | KZKDUMQZFXZCBU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|