C18H23NO4 — CID 145068213
tert-butyl 3-(4-methylbenzoyl)-2-oxopiperidine-1-carboxylate (PubChem CID 145068213) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is tert-butyl 3-(4-methylbenzoyl)-2-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-methylbenzoyl)-2-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 145068213 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | tert-butyl 3-(4-methylbenzoyl)-2-oxopiperidine-1-carboxylate |
| SMILES | Cc1ccc(C(=O)C2CCCN(C(=O)OC(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C18H23NO4/c1-12-7-9-13(10-8-12)15(20)14-6-5-11-19(16(14)21)17(22)23-18(2,3)4/h7-10,14H,5-6,11H2,1-4H3 |
| InChIKey | NLMFXGRDNXZPQG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|