C18H22BrNO4 — CID 164750824
tert-butyl 3-(4-bromobenzoyl)-5-methyl-2-oxopiperidine-1-carboxylate (PubChem CID 164750824) has the molecular formula C18H22BrNO4 and a molecular weight of 396.28 g/mol. Its IUPAC name is tert-butyl 3-(4-bromobenzoyl)-5-methyl-2-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-bromobenzoyl)-5-methyl-2-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 164750824 |
| Molecular Formula | C18H22BrNO4 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | tert-butyl 3-(4-bromobenzoyl)-5-methyl-2-oxopiperidine-1-carboxylate |
| SMILES | CC1CC(C(=O)c2ccc(Br)cc2)C(=O)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H22BrNO4/c1-11-9-14(15(21)12-5-7-13(19)8-6-12)16(22)20(10-11)17(23)24-18(2,3)4/h5-8,11,14H,9-10H2,1-4H3 |
| InChIKey | FDKQIDVSTQXBOJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|