C18H20ClNO6 — CID 11749365
1-O-tert-butyl 2-O-methyl (2S)-4-(4-chlorobenzoyl)-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 11749365) has the molecular formula C18H20ClNO6 and a molecular weight of 381.81 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S)-4-(4-chlorobenzoyl)-5-oxopyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S)-4-(4-chlorobenzoyl)-5-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11749365 |
| Molecular Formula | C18H20ClNO6 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S)-4-(4-chlorobenzoyl)-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC(C(=O)c2ccc(Cl)cc2)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H20ClNO6/c1-18(2,3)26-17(24)20-13(16(23)25-4)9-12(15(20)22)14(21)10-5-7-11(19)8-6-10/h5-8,12-13H,9H2,1-4H3/t12?,13-/m0/s1 |
| InChIKey | RPZKLHXDLGDAIC-ABLWVSNPSA-N |
| XLogP | 2.85 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|