C13H19NO7 — CID 15516197
1-O-tert-butyl 2-O-methyl (2S,4R)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 15516197) has the molecular formula C13H19NO7 and a molecular weight of 301.30 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 15516197 |
| Molecular Formula | C13H19NO7 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](OC(C)=O)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H19NO7/c1-7(15)20-9-6-8(11(17)19-5)14(10(9)16)12(18)21-13(2,3)4/h8-9H,6H2,1-5H3/t8-,9+/m0/s1 |
| InChIKey | RHEQUDWGMKKFLV-DTWKUNHWSA-N |
| XLogP | 0.63 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|