C21H31ClN2O4 — CID 143563421
ethane;methyl (2R)-1-(4-chlorobenzoyl)-4-[1-[(2-methylpropan-2-yl)oxy]ethenyl]piperazine-2-carboxylate (PubChem CID 143563421) has the molecular formula C21H31ClN2O4 and a molecular weight of 410.94 g/mol. Its IUPAC name is ethane;methyl (2R)-1-(4-chlorobenzoyl)-4-[1-[(2-methylpropan-2-yl)oxy]ethenyl]piperazine-2-carboxylate.
| Compound Name | ethane;methyl (2R)-1-(4-chlorobenzoyl)-4-[1-[(2-methylpropan-2-yl)oxy]ethenyl]piperazine-2-carboxylate |
|---|---|
| PubChem CID | 143563421 |
| Molecular Formula | C21H31ClN2O4 |
| Molecular Weight | 410.94 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | ethane;methyl (2R)-1-(4-chlorobenzoyl)-4-[1-[(2-methylpropan-2-yl)oxy]ethenyl]piperazine-2-carboxylate |
| SMILES | C=C(OC(C)(C)C)N1CCN(C(=O)c2ccc(Cl)cc2)[C@@H](C(=O)OC)C1.CC |
| InChI | InChI=1S/C19H25ClN2O4.C2H6/c1-13(26-19(2,3)4)21-10-11-22(16(12-21)18(24)25-5)17(23)14-6-8-15(20)9-7-14;1-2/h6-9,16H,1,10-12H2,2-5H3;1-2H3/t16-;/m1./s1 |
| InChIKey | NUDYZZLGHKSFBT-PKLMIRHRSA-N |
| XLogP | 3.95 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.94 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|