C13H18F3NO5 — CID 170408480
1-O-tert-butyl 3-O-methyl (5R)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylate (PubChem CID 170408480) has the molecular formula C13H18F3NO5 and a molecular weight of 325.28 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl (5R)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl (5R)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 170408480 |
| Molecular Formula | C13H18F3NO5 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl (5R)-2-oxo-5-(trifluoromethyl)piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1C[C@@H](C(F)(F)F)CN(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C13H18F3NO5/c1-12(2,3)22-11(20)17-6-7(13(14,15)16)5-8(9(17)18)10(19)21-4/h7-8H,5-6H2,1-4H3/t7-,8?/m1/s1 |
| InChIKey | SMMYOOZSIOVILB-GVHYBUMESA-N |
| XLogP | 2.12 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|