C11H16F3NO3 — CID 162422265
tert-butyl 3-oxo-5-(trifluoromethyl)piperidine-1-carboxylate (PubChem CID 162422265) has the molecular formula C11H16F3NO3 and a molecular weight of 267.25 g/mol. Its IUPAC name is tert-butyl 3-oxo-5-(trifluoromethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-oxo-5-(trifluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162422265 |
| Molecular Formula | C11H16F3NO3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | tert-butyl 3-oxo-5-(trifluoromethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H16F3NO3/c1-10(2,3)18-9(17)15-5-7(11(12,13)14)4-8(16)6-15/h7H,4-6H2,1-3H3 |
| InChIKey | ICLGWQBTFHOQTG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |