C10H15F2NO3 — CID 105495801
tert-butyl 3-(1,1-difluoro-2-oxoethyl)azetidine-1-carboxylate (PubChem CID 105495801) has the molecular formula C10H15F2NO3 and a molecular weight of 235.23 g/mol. Its IUPAC name is tert-butyl 3-(1,1-difluoro-2-oxoethyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(1,1-difluoro-2-oxoethyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 105495801 |
| Molecular Formula | C10H15F2NO3 |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | tert-butyl 3-(1,1-difluoro-2-oxoethyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(F)(F)C=O)C1 |
| InChI | InChI=1S/C10H15F2NO3/c1-9(2,3)16-8(15)13-4-7(5-13)10(11,12)6-14/h6-7H,4-5H2,1-3H3 |
| InChIKey | TUTSVGITYTZIOT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|