C10H16ClNO4 — CID 170354095
tert-butyl 3,5-dioxopiperidine-1-carboxylate;hydrochloride (PubChem CID 170354095) has the molecular formula C10H16ClNO4 and a molecular weight of 249.69 g/mol. Its IUPAC name is tert-butyl 3,5-dioxopiperidine-1-carboxylate;hydrochloride.
| Compound Name | tert-butyl 3,5-dioxopiperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 170354095 |
| Molecular Formula | C10H16ClNO4 |
| Molecular Weight | 249.69 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | tert-butyl 3,5-dioxopiperidine-1-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CC(=O)C1.Cl |
| InChI | InChI=1S/C10H15NO4.ClH/c1-10(2,3)15-9(14)11-5-7(12)4-8(13)6-11;/h4-6H2,1-3H3;1H |
| InChIKey | JMNHYDNDRQJCPO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.69 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|