C14H24N4O7 — CID 160911795
tert-butyl 3,5-dioxopiperazine-1-carboxylate;methanol;piperazine-2,6-dione (PubChem CID 160911795) has the molecular formula C14H24N4O7 and a molecular weight of 360.37 g/mol. Its IUPAC name is tert-butyl 3,5-dioxopiperazine-1-carboxylate;methanol;piperazine-2,6-dione.
| Compound Name | tert-butyl 3,5-dioxopiperazine-1-carboxylate;methanol;piperazine-2,6-dione |
|---|---|
| PubChem CID | 160911795 |
| Molecular Formula | C14H24N4O7 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | tert-butyl 3,5-dioxopiperazine-1-carboxylate;methanol;piperazine-2,6-dione |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)NC(=O)C1.CO.O=C1CNCC(=O)N1 |
| InChI | InChI=1S/C9H14N2O4.C4H6N2O2.CH4O/c1-9(2,3)15-8(14)11-4-6(12)10-7(13)5-11;7-3-1-5-2-4(8)6-3;1-2/h4-5H2,1-3H3,(H,10,12,13);5H,1-2H2,(H,6,7,8);2H,1H3 |
| InChIKey | SQWPSXGSCVNHJF-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|