C9H12N2O4S2 — CID 90205644
tert-butyl 4,6-dioxo-1,2-dithia-5,8-diazaspiro[2.5]octane-8-carboxylate (PubChem CID 90205644) has the molecular formula C9H12N2O4S2 and a molecular weight of 276.34 g/mol. Its IUPAC name is tert-butyl 4,6-dioxo-1,2-dithia-5,8-diazaspiro[2.5]octane-8-carboxylate.
| Compound Name | tert-butyl 4,6-dioxo-1,2-dithia-5,8-diazaspiro[2.5]octane-8-carboxylate |
|---|---|
| PubChem CID | 90205644 |
| Molecular Formula | C9H12N2O4S2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | tert-butyl 4,6-dioxo-1,2-dithia-5,8-diazaspiro[2.5]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)NC(=O)C12SS2 |
| InChI | InChI=1S/C9H12N2O4S2/c1-8(2,3)15-7(14)11-4-5(12)10-6(13)9(11)16-17-9/h4H2,1-3H3,(H,10,12,13) |
| InChIKey | QXEDPEBMSLEAGU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|