C13H20N2O5 — CID 176523151
tert-butyl 2-ethoxy-2-methyl-3-oxo-5-(oxomethylidene)piperazine-1-carboxylate (PubChem CID 176523151) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is tert-butyl 2-ethoxy-2-methyl-3-oxo-5-(oxomethylidene)piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-ethoxy-2-methyl-3-oxo-5-(oxomethylidene)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176523151 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | tert-butyl 2-ethoxy-2-methyl-3-oxo-5-(oxomethylidene)piperazine-1-carboxylate |
| SMILES | CCOC1(C)C(=O)NC(=C=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20N2O5/c1-6-19-13(5)10(17)14-9(8-16)7-15(13)11(18)20-12(2,3)4/h6-7H2,1-5H3,(H,14,17) |
| InChIKey | FCGRWHBFLCSOMN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|