C15H30N2O2 — CID 90013842
tert-butyl 2,2-diethyl-5,5-dimethylpiperazine-1-carboxylate (PubChem CID 90013842) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is tert-butyl 2,2-diethyl-5,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 2,2-diethyl-5,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 90013842 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | tert-butyl 2,2-diethyl-5,5-dimethylpiperazine-1-carboxylate |
| SMILES | CCC1(CC)CNC(C)(C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-8-15(9-2)10-16-14(6,7)11-17(15)12(18)19-13(3,4)5/h16H,8-11H2,1-7H3 |
| InChIKey | VAUXLEXSISBJSX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |