C15H28N2O4 — CID 86337386
ditert-butyl (2S)-2-methylpiperazine-1,2-dicarboxylate (PubChem CID 86337386) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is ditert-butyl (2S)-2-methylpiperazine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S)-2-methylpiperazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 86337386 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | ditert-butyl (2S)-2-methylpiperazine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNC[C@@]1(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N2O4/c1-13(2,3)20-11(18)15(7)10-16-8-9-17(15)12(19)21-14(4,5)6/h16H,8-10H2,1-7H3/t15-/m0/s1 |
| InChIKey | DZQBIJYYGJGBQM-HNNXBMFYSA-N |
| XLogP | 1.93 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |