C13H22N2O3 — CID 141188760
tert-butyl 4-oxo-6,9-diazaspiro[4.5]decane-6-carboxylate (PubChem CID 141188760) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is tert-butyl 4-oxo-6,9-diazaspiro[4.5]decane-6-carboxylate.
| Compound Name | tert-butyl 4-oxo-6,9-diazaspiro[4.5]decane-6-carboxylate |
|---|---|
| PubChem CID | 141188760 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | tert-butyl 4-oxo-6,9-diazaspiro[4.5]decane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC12CCCC2=O |
| InChI | InChI=1S/C13H22N2O3/c1-12(2,3)18-11(17)15-8-7-14-9-13(15)6-4-5-10(13)16/h14H,4-9H2,1-3H3 |
| InChIKey | FYFNLMUIWDXUFZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |