C13H22N2O6 — CID 118705199
tert-butyl 1,7-diazaspiro[3.4]octane-1-carboxylate;oxalic acid (PubChem CID 118705199) has the molecular formula C13H22N2O6 and a molecular weight of 302.33 g/mol. Its IUPAC name is tert-butyl 1,7-diazaspiro[3.4]octane-1-carboxylate;oxalic acid.
| Compound Name | tert-butyl 1,7-diazaspiro[3.4]octane-1-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 118705199 |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | tert-butyl 1,7-diazaspiro[3.4]octane-1-carboxylate;oxalic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC12CCNC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H20N2O2.C2H2O4/c1-10(2,3)15-9(14)13-7-5-11(13)4-6-12-8-11;3-1(4)2(5)6/h12H,4-8H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | XWUVWGSPBULRIO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|