C14H24N2O6 — CID 53484576
tert-butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate;oxalic acid (PubChem CID 53484576) has the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. Its IUPAC name is tert-butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate;oxalic acid.
| Compound Name | tert-butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 53484576 |
| Molecular Formula | C14H24N2O6 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | tert-butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate;oxalic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CNC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H22N2O2.C2H2O4/c1-11(2,3)16-10(15)14-6-4-12(5-7-14)8-13-9-12;3-1(4)2(5)6/h13H,4-9H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | SMOGGVSZSAELAA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|