C28H50N4O8 — CID 91800935
bis(tert-butyl 2,6-diazaspiro[4.5]decane-6-carboxylate);oxalic acid (PubChem CID 91800935) has the molecular formula C28H50N4O8 and a molecular weight of 570.73 g/mol. Its IUPAC name is bis(tert-butyl 2,6-diazaspiro[4.5]decane-6-carboxylate);oxalic acid.
| Compound Name | bis(tert-butyl 2,6-diazaspiro[4.5]decane-6-carboxylate);oxalic acid |
|---|---|
| PubChem CID | 91800935 |
| Molecular Formula | C28H50N4O8 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | bis(tert-butyl 2,6-diazaspiro[4.5]decane-6-carboxylate);oxalic acid |
| SMILES | CC(C)(C)OC(=O)N1CCCCC12CCNC2.CC(C)(C)OC(=O)N1CCCCC12CCNC2.O=C(O)C(=O)O |
| InChI | InChI=1S/2C13H24N2O2.C2H2O4/c2*1-12(2,3)17-11(16)15-9-5-4-6-13(15)7-8-14-10-13;3-1(4)2(5)6/h2*14H,4-10H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | QMWAZGQMSXUQPA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 157.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|