C15H26N2O3 — CID 139383963
tert-butyl 12-oxo-1,11-diazaspiro[5.6]dodecane-1-carboxylate (PubChem CID 139383963) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is tert-butyl 12-oxo-1,11-diazaspiro[5.6]dodecane-1-carboxylate.
| Compound Name | tert-butyl 12-oxo-1,11-diazaspiro[5.6]dodecane-1-carboxylate |
|---|---|
| PubChem CID | 139383963 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | tert-butyl 12-oxo-1,11-diazaspiro[5.6]dodecane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC12CCCCNC2=O |
| InChI | InChI=1S/C15H26N2O3/c1-14(2,3)20-13(19)17-11-7-5-9-15(17)8-4-6-10-16-12(15)18/h4-11H2,1-3H3,(H,16,18) |
| InChIKey | NOFXHWOWJRJWCK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |