C17H36N2O3Si — CID 178167079
tert-butyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylpiperazine-1-carboxylate (PubChem CID 178167079) has the molecular formula C17H36N2O3Si and a molecular weight of 344.57 g/mol. Its IUPAC name is tert-butyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 178167079 |
| Molecular Formula | C17H36N2O3Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | tert-butyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36N2O3Si/c1-15(2,3)22-14(20)19-11-10-18-12-17(19,7)13-21-23(8,9)16(4,5)6/h18H,10-13H2,1-9H3 |
| InChIKey | PBEHVBIXDHKVFY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|