3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate

C13H26N2O2 — CID 141044506

IUPAC3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate
SMILESCCC(C)(CC)OC(=O)N1CCNCC1(C)C
InChIInChI=1S/C13H26N2O2/c1-6-13(5,7-2)17-11(16)15-9-8-14-10-12(15,3)4/h14H,6-10H2,1-5H3
InChIKeyLBWUGNBNJWXFIP-UHFFFAOYSA-N
MW242.36 g/mol
LogP2.39
Rot. Bonds3

About 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate

3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate (PubChem CID 141044506) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate.

Molecular Properties

Compound Name3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate
PubChem CID141044506
Molecular FormulaC13H26N2O2
Molecular Weight242.36 g/mol
Exact Mass242.20
IUPAC Name3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate
SMILESCCC(C)(CC)OC(=O)N1CCNCC1(C)C
InChIInChI=1S/C13H26N2O2/c1-6-13(5,7-2)17-11(16)15-9-8-14-10-12(15,3)4/h14H,6-10H2,1-5H3
InChIKeyLBWUGNBNJWXFIP-UHFFFAOYSA-N
XLogP2.39
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.36
LogP ≤ 52.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate?
The IUPAC name of 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate (CID 141044506) is 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate.
What is the SMILES notation for 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate?
The canonical SMILES for 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate is CCC(C)(CC)OC(=O)N1CCNCC1(C)C.
What is the InChIKey of 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate?
The InChIKey is LBWUGNBNJWXFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2/c1-6-13(5,7-2)17-11(16)15-9-8-14-10-12(15,3)4/h14H,6-10H2,1-5H3.
What are the key properties of 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate?
3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate has a molecular weight of 242.36 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate is sourced from PubChem (CID 141044506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).