C13H26N2O2 — CID 141044506
3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate (PubChem CID 141044506) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate.
| Compound Name | 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 141044506 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 3-methylpentan-3-yl 2,2-dimethylpiperazine-1-carboxylate |
| SMILES | CCC(C)(CC)OC(=O)N1CCNCC1(C)C |
| InChI | InChI=1S/C13H26N2O2/c1-6-13(5,7-2)17-11(16)15-9-8-14-10-12(15,3)4/h14H,6-10H2,1-5H3 |
| InChIKey | LBWUGNBNJWXFIP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |