About 2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone
2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone (PubChem CID 79001733) has the molecular formula C10H21N3O
and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone |
| PubChem CID | 79001733 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone |
| SMILES | CN(C)CC(=O)N1CCNCC1(C)C |
| InChI | InChI=1S/C10H21N3O/c1-10(2)8-11-5-6-13(10)9(14)7-12(3)4/h11H,5-8H2,1-4H3 |
| InChIKey | QUKRBBRRNVGVHZ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone?
The IUPAC name of 2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone (CID 79001733) is 2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone.
What is the SMILES notation for 2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone?
The canonical SMILES for 2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone is CN(C)CC(=O)N1CCNCC1(C)C.
What is the InChIKey of 2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone?
The InChIKey is QUKRBBRRNVGVHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O/c1-10(2)8-11-5-6-13(10)9(14)7-12(3)4/h11H,5-8H2,1-4H3.
What are the key properties of 2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone?
2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone has a molecular weight of 199.30 g/mol, XLogP of -0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-1-(2,2-dimethylpiperazin-1-yl)ethanone is sourced from PubChem (CID 79001733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).