C14H22N2O6 — CID 101100447
ditert-butyl 3,6-dioxodiazinane-1,2-dicarboxylate (PubChem CID 101100447) has the molecular formula C14H22N2O6 and a molecular weight of 314.34 g/mol. Its IUPAC name is ditert-butyl 3,6-dioxodiazinane-1,2-dicarboxylate.
| Compound Name | ditert-butyl 3,6-dioxodiazinane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101100447 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | ditert-butyl 3,6-dioxodiazinane-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CCC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22N2O6/c1-13(2,3)21-11(19)15-9(17)7-8-10(18)16(15)12(20)22-14(4,5)6/h7-8H2,1-6H3 |
| InChIKey | WNKUKQGHQOGVNE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |