C14H21NO4 — CID 58574724
tert-butyl 2,8-dioxo-1-azaspiro[4.5]decane-1-carboxylate (PubChem CID 58574724) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is tert-butyl 2,8-dioxo-1-azaspiro[4.5]decane-1-carboxylate.
| Compound Name | tert-butyl 2,8-dioxo-1-azaspiro[4.5]decane-1-carboxylate |
|---|---|
| PubChem CID | 58574724 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | tert-butyl 2,8-dioxo-1-azaspiro[4.5]decane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CCC12CCC(=O)CC2 |
| InChI | InChI=1S/C14H21NO4/c1-13(2,3)19-12(18)15-11(17)6-9-14(15)7-4-10(16)5-8-14/h4-9H2,1-3H3 |
| InChIKey | RDQCKKNTWDKBME-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |