C13H20N4O3 — CID 158092707
tert-butyl 3-oxopiperazine-1-carboxylate;pyrazine (PubChem CID 158092707) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is tert-butyl 3-oxopiperazine-1-carboxylate;pyrazine.
| Compound Name | tert-butyl 3-oxopiperazine-1-carboxylate;pyrazine |
|---|---|
| PubChem CID | 158092707 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | tert-butyl 3-oxopiperazine-1-carboxylate;pyrazine |
| SMILES | CC(C)(C)OC(=O)N1CCNC(=O)C1.c1cnccn1 |
| InChI | InChI=1S/C9H16N2O3.C4H4N2/c1-9(2,3)14-8(13)11-5-4-10-7(12)6-11;1-2-6-4-3-5-1/h4-6H2,1-3H3,(H,10,12);1-4H |
| InChIKey | FOHLCPGDRUWNCT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |