C16H28N4O5S — CID 87812611
tert-butyl 5-oxo-1,4-diazepane-1-carboxylate;5-sulfanylidene-1,4-diazepane-1-carboxylic acid (PubChem CID 87812611) has the molecular formula C16H28N4O5S and a molecular weight of 388.49 g/mol. Its IUPAC name is tert-butyl 5-oxo-1,4-diazepane-1-carboxylate;5-sulfanylidene-1,4-diazepane-1-carboxylic acid.
| Compound Name | tert-butyl 5-oxo-1,4-diazepane-1-carboxylate;5-sulfanylidene-1,4-diazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 87812611 |
| Molecular Formula | C16H28N4O5S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | tert-butyl 5-oxo-1,4-diazepane-1-carboxylate;5-sulfanylidene-1,4-diazepane-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CCNC(=O)CC1.O=C(O)N1CCNC(=S)CC1 |
| InChI | InChI=1S/C10H18N2O3.C6H10N2O2S/c1-10(2,3)15-9(14)12-6-4-8(13)11-5-7-12;9-6(10)8-3-1-5(11)7-2-4-8/h4-7H2,1-3H3,(H,11,13);1-4H2,(H,7,11)(H,9,10) |
| InChIKey | SHTVYKJQPBGXLH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|