C14H24N2O2S — CID 167205373
tert-butyl 10-sulfanylidene-3,9-diazaspiro[5.5]undecane-3-carboxylate (PubChem CID 167205373) has the molecular formula C14H24N2O2S and a molecular weight of 284.42 g/mol. Its IUPAC name is tert-butyl 10-sulfanylidene-3,9-diazaspiro[5.5]undecane-3-carboxylate.
| Compound Name | tert-butyl 10-sulfanylidene-3,9-diazaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 167205373 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | tert-butyl 10-sulfanylidene-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCNC(=S)C2)CC1 |
| InChI | InChI=1S/C14H24N2O2S/c1-13(2,3)18-12(17)16-8-5-14(6-9-16)4-7-15-11(19)10-14/h4-10H2,1-3H3,(H,15,19) |
| InChIKey | MIRMXRVMUASIPV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|