C14H28N2O4 — CID 169255055
tert-butyl 3-(2-hydroxypropan-2-yl)-5-oxopiperazine-1-carboxylate;ethane (PubChem CID 169255055) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is tert-butyl 3-(2-hydroxypropan-2-yl)-5-oxopiperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-(2-hydroxypropan-2-yl)-5-oxopiperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 169255055 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | tert-butyl 3-(2-hydroxypropan-2-yl)-5-oxopiperazine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CC(=O)NC(C(C)(C)O)C1 |
| InChI | InChI=1S/C12H22N2O4.C2H6/c1-11(2,3)18-10(16)14-6-8(12(4,5)17)13-9(15)7-14;1-2/h8,17H,6-7H2,1-5H3,(H,13,15);1-2H3 |
| InChIKey | WFSOHRFWYGPOTR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |