C16H32N2O4Si — CID 170904003
tert-butyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxopiperazine-1-carboxylate (PubChem CID 170904003) has the molecular formula C16H32N2O4Si and a molecular weight of 344.53 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 170904003 |
| Molecular Formula | C16H32N2O4Si |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | tert-butyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxopiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)N[C@@H](CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C16H32N2O4Si/c1-15(2,3)22-14(20)18-9-12(17-13(19)10-18)11-21-23(7,8)16(4,5)6/h12H,9-11H2,1-8H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | KTHNSWYUZFFXHX-GFCCVEGCSA-N |
| XLogP | 2.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|