C16H33NO4Si — CID 67633255
tert-butyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxypyrrolidine-1-carboxylate (PubChem CID 67633255) has the molecular formula C16H33NO4Si and a molecular weight of 331.53 g/mol. Its IUPAC name is tert-butyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67633255 |
| Molecular Formula | C16H33NO4Si |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | tert-butyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(O)CCC1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33NO4Si/c1-15(2,3)21-14(19)17-12(9-10-13(17)18)11-20-22(7,8)16(4,5)6/h12-13,18H,9-11H2,1-8H3 |
| InChIKey | NKSVCXXGSNDLEP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|