C24H45NO3Si — CID 122400427
tert-butyl (2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[3-(cyclopenten-1-yl)propyl]pyrrolidine-1-carboxylate (PubChem CID 122400427) has the molecular formula C24H45NO3Si and a molecular weight of 423.71 g/mol. Its IUPAC name is tert-butyl (2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[3-(cyclopenten-1-yl)propyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[3-(cyclopenten-1-yl)propyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 122400427 |
| Molecular Formula | C24H45NO3Si |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 423.32 |
| IUPAC Name | tert-butyl (2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[3-(cyclopenten-1-yl)propyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CCCC2=CCCC2)CC[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H45NO3Si/c1-23(2,3)28-22(26)25-20(15-11-14-19-12-9-10-13-19)16-17-21(25)18-27-29(7,8)24(4,5)6/h12,20-21H,9-11,13-18H2,1-8H3/t20-,21-/m0/s1 |
| InChIKey | UIPUHDNGRDOSAZ-SFTDATJTSA-N |
| XLogP | 7.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|