C17H32N2O3Si — CID 132515167
tert-butyl (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-cyanopyrrolidine-1-carboxylate (PubChem CID 132515167) has the molecular formula C17H32N2O3Si and a molecular weight of 340.54 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-cyanopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-cyanopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 132515167 |
| Molecular Formula | C17H32N2O3Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | tert-butyl (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-cyanopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C#N)CC[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32N2O3Si/c1-16(2,3)22-15(20)19-13(11-18)9-10-14(19)12-21-23(7,8)17(4,5)6/h13-14H,9-10,12H2,1-8H3/t13?,14-/m1/s1 |
| InChIKey | UBIFYBRWKHTEME-ARLHGKGLSA-N |
| XLogP | 4.30 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|