C25H50NO7PSi — CID 134949806
tert-butyl (2S,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-(5-dimethoxyphosphoryl-4-oxopentyl)piperidine-1-carboxylate (PubChem CID 134949806) has the molecular formula C25H50NO7PSi and a molecular weight of 535.74 g/mol. Its IUPAC name is tert-butyl (2S,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-(5-dimethoxyphosphoryl-4-oxopentyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-(5-dimethoxyphosphoryl-4-oxopentyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134949806 |
| Molecular Formula | C25H50NO7PSi |
| Molecular Weight | 535.74 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | tert-butyl (2S,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-(5-dimethoxyphosphoryl-4-oxopentyl)piperidine-1-carboxylate |
| SMILES | COP(=O)(CC(=O)CCC[C@@H]1CCC[C@@H](CCO[Si](C)(C)C(C)(C)C)N1C(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C25H50NO7PSi/c1-24(2,3)33-23(28)26-20(15-12-16-22(27)19-34(29,30-7)31-8)13-11-14-21(26)17-18-32-35(9,10)25(4,5)6/h20-21H,11-19H2,1-10H3/t20-,21-/m0/s1 |
| InChIKey | GQYQQKCGJZPCOW-SFTDATJTSA-N |
| XLogP | 6.78 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.74 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|