C19H35NO7Si — CID 10002054
dimethyl (2R,3S,6S)-3-acetyloxy-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperidine-1,2-dicarboxylate (PubChem CID 10002054) has the molecular formula C19H35NO7Si and a molecular weight of 417.58 g/mol. Its IUPAC name is dimethyl (2R,3S,6S)-3-acetyloxy-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperidine-1,2-dicarboxylate.
| Compound Name | dimethyl (2R,3S,6S)-3-acetyloxy-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10002054 |
| Molecular Formula | C19H35NO7Si |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | dimethyl (2R,3S,6S)-3-acetyloxy-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](OC(C)=O)CC[C@@H](CCO[Si](C)(C)C(C)(C)C)N1C(=O)OC |
| InChI | InChI=1S/C19H35NO7Si/c1-13(21)27-15-10-9-14(11-12-26-28(7,8)19(2,3)4)20(18(23)25-6)16(15)17(22)24-5/h14-16H,9-12H2,1-8H3/t14-,15-,16+/m0/s1 |
| InChIKey | XYMBAMGJXFLCIT-HRCADAONSA-N |
| XLogP | 3.10 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|