C11H23NO4SSi — CID 175321794
(4S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxathiazolidine-3-carboxylic acid (PubChem CID 175321794) has the molecular formula C11H23NO4SSi and a molecular weight of 293.46 g/mol. Its IUPAC name is (4S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxathiazolidine-3-carboxylic acid.
| Compound Name | (4S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxathiazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 175321794 |
| Molecular Formula | C11H23NO4SSi |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (4S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxathiazolidine-3-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H]1COSN1C(=O)O |
| InChI | InChI=1S/C11H23NO4SSi/c1-11(2,3)18(4,5)16-7-6-9-8-15-17-12(9)10(13)14/h9H,6-8H2,1-5H3,(H,13,14)/t9-/m0/s1 |
| InChIKey | OTUHAYIFZWWYCG-VIFPVBQESA-N |
| XLogP | 3.34 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|