C30H43NO5S2Si — CID 10918999
methyl (2S,3R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(1,3-dithiolan-2-yl)-3-(methoxymethoxy)piperidine-1-carboxylate (PubChem CID 10918999) has the molecular formula C30H43NO5S2Si and a molecular weight of 589.90 g/mol. Its IUPAC name is methyl (2S,3R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(1,3-dithiolan-2-yl)-3-(methoxymethoxy)piperidine-1-carboxylate.
| Compound Name | methyl (2S,3R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(1,3-dithiolan-2-yl)-3-(methoxymethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10918999 |
| Molecular Formula | C30H43NO5S2Si |
| Molecular Weight | 589.90 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | methyl (2S,3R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-(1,3-dithiolan-2-yl)-3-(methoxymethoxy)piperidine-1-carboxylate |
| SMILES | COCO[C@@H]1CC[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)OC)[C@@H]1C1SCCS1 |
| InChI | InChI=1S/C30H43NO5S2Si/c1-30(2,3)39(24-12-8-6-9-13-24,25-14-10-7-11-15-25)36-19-18-23-16-17-26(35-22-33-4)27(28-37-20-21-38-28)31(23)29(32)34-5/h6-15,23,26-28H,16-22H2,1-5H3/t23-,26-,27+/m1/s1 |
| InChIKey | MNNSGUXYKZMANI-MVNQZMKCSA-N |
| XLogP | 5.35 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.90 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|