C25H33NO3Si — CID 73293002
(4aS,7R)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one (PubChem CID 73293002) has the molecular formula C25H33NO3Si and a molecular weight of 423.63 g/mol. Its IUPAC name is (4aS,7R)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one.
| Compound Name | (4aS,7R)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one |
|---|---|
| PubChem CID | 73293002 |
| Molecular Formula | C25H33NO3Si |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (4aS,7R)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one |
| SMILES | CC(C)(C)[Si](OCC[C@H]1CC[C@H]2CCOC(=O)N21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H33NO3Si/c1-25(2,3)30(22-10-6-4-7-11-22,23-12-8-5-9-13-23)29-19-17-21-15-14-20-16-18-28-24(27)26(20)21/h4-13,20-21H,14-19H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | BDOHGQJFYOHOLE-LEWJYISDSA-N |
| XLogP | 4.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|