C31H38O3SeSi — CID 24808080
(4R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-4-phenylselanylbutan-2-yl]oxan-2-one (PubChem CID 24808080) has the molecular formula C31H38O3SeSi and a molecular weight of 565.69 g/mol. Its IUPAC name is (4R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-4-phenylselanylbutan-2-yl]oxan-2-one.
| Compound Name | (4R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-4-phenylselanylbutan-2-yl]oxan-2-one |
|---|---|
| PubChem CID | 24808080 |
| Molecular Formula | C31H38O3SeSi |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | (4R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-4-phenylselanylbutan-2-yl]oxan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H](CC[Se]c1ccccc1)[C@@H]1CCOC(=O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H38O3SeSi/c1-31(2,3)36(28-15-9-5-10-16-28,29-17-11-6-12-18-29)34-24-26(25-19-21-33-30(32)23-25)20-22-35-27-13-7-4-8-14-27/h4-18,25-26H,19-24H2,1-3H3/t25-,26+/m1/s1 |
| InChIKey | BDIMGBPBQQVMFP-FTJBHMTQSA-N |
| XLogP | 4.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|