C25H30O2SeSi — CID 11305910
(2R)-1-[tert-butyl(diphenyl)silyl]oxy-3-phenylselanylpropan-2-ol (PubChem CID 11305910) has the molecular formula C25H30O2SeSi and a molecular weight of 469.56 g/mol. Its IUPAC name is (2R)-1-[tert-butyl(diphenyl)silyl]oxy-3-phenylselanylpropan-2-ol.
| Compound Name | (2R)-1-[tert-butyl(diphenyl)silyl]oxy-3-phenylselanylpropan-2-ol |
|---|---|
| PubChem CID | 11305910 |
| Molecular Formula | C25H30O2SeSi |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | (2R)-1-[tert-butyl(diphenyl)silyl]oxy-3-phenylselanylpropan-2-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H](O)C[Se]c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H30O2SeSi/c1-25(2,3)29(23-15-9-5-10-16-23,24-17-11-6-12-18-24)27-19-21(26)20-28-22-13-7-4-8-14-22/h4-18,21,26H,19-20H2,1-3H3/t21-/m1/s1 |
| InChIKey | LNFWIJMDENAPBG-OAQYLSRUSA-N |
| XLogP | 3.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|