C28H37NO5Si — CID 122217414
methyl (E)-6-[tert-butyl(diphenyl)silyl]oxy-3-ethyl-2-(2-oxo-1,3-oxazolidin-3-yl)hex-2-enoate (PubChem CID 122217414) has the molecular formula C28H37NO5Si and a molecular weight of 495.69 g/mol. Its IUPAC name is methyl (E)-6-[tert-butyl(diphenyl)silyl]oxy-3-ethyl-2-(2-oxo-1,3-oxazolidin-3-yl)hex-2-enoate.
| Compound Name | methyl (E)-6-[tert-butyl(diphenyl)silyl]oxy-3-ethyl-2-(2-oxo-1,3-oxazolidin-3-yl)hex-2-enoate |
|---|---|
| PubChem CID | 122217414 |
| Molecular Formula | C28H37NO5Si |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | methyl (E)-6-[tert-butyl(diphenyl)silyl]oxy-3-ethyl-2-(2-oxo-1,3-oxazolidin-3-yl)hex-2-enoate |
| SMILES | CC/C(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)=C(/C(=O)OC)N1CCOC1=O |
| InChI | InChI=1S/C28H37NO5Si/c1-6-22(25(26(30)32-5)29-19-21-33-27(29)31)14-13-20-34-35(28(2,3)4,23-15-9-7-10-16-23)24-17-11-8-12-18-24/h7-12,15-18H,6,13-14,19-21H2,1-5H3/b25-22+ |
| InChIKey | FQJUNSLKZZRSTR-YYDJUVGSSA-N |
| XLogP | 4.63 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|