C27H35NO3Si — CID 135023889
3-[6-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethylhexa-1,2-dienyl]-1,3-oxazolidin-2-one (PubChem CID 135023889) has the molecular formula C27H35NO3Si and a molecular weight of 449.67 g/mol. Its IUPAC name is 3-[6-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethylhexa-1,2-dienyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[6-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethylhexa-1,2-dienyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135023889 |
| Molecular Formula | C27H35NO3Si |
| Molecular Weight | 449.67 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 3-[6-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethylhexa-1,2-dienyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C=C=CN1CCOC1=O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H35NO3Si/c1-26(2,3)32(23-13-8-6-9-14-23,24-15-10-7-11-16-24)31-21-18-27(4,5)17-12-19-28-20-22-30-25(28)29/h6-11,13-17,19H,18,20-22H2,1-5H3 |
| InChIKey | DFVFILICUXLLCT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|