C28H43NO5SSi — CID 15946583
[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutyl] 2-morpholin-4-ylethanesulfonate (PubChem CID 15946583) has the molecular formula C28H43NO5SSi and a molecular weight of 533.81 g/mol. Its IUPAC name is [4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutyl] 2-morpholin-4-ylethanesulfonate.
| Compound Name | [4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutyl] 2-morpholin-4-ylethanesulfonate |
|---|---|
| PubChem CID | 15946583 |
| Molecular Formula | C28H43NO5SSi |
| Molecular Weight | 533.81 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | [4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutyl] 2-morpholin-4-ylethanesulfonate |
| SMILES | CC(C)(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)COS(=O)(=O)CCN1CCOCC1 |
| InChI | InChI=1S/C28H43NO5SSi/c1-27(2,3)36(25-12-8-6-9-13-25,26-14-10-7-11-15-26)34-20-16-28(4,5)24-33-35(30,31)23-19-29-17-21-32-22-18-29/h6-15H,16-24H2,1-5H3 |
| InChIKey | FRBQPOCBHGZCSR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|