C30H45NO2Si — CID 57427861
tert-butyl-[2-[1-(2-morpholin-4-ylethyl)cyclohexyl]ethoxy]-diphenylsilane (PubChem CID 57427861) has the molecular formula C30H45NO2Si and a molecular weight of 479.78 g/mol. Its IUPAC name is tert-butyl-[2-[1-(2-morpholin-4-ylethyl)cyclohexyl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[1-(2-morpholin-4-ylethyl)cyclohexyl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 57427861 |
| Molecular Formula | C30H45NO2Si |
| Molecular Weight | 479.78 g/mol |
| Exact Mass | 479.32 |
| IUPAC Name | tert-butyl-[2-[1-(2-morpholin-4-ylethyl)cyclohexyl]ethoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCC1(CCN2CCOCC2)CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H45NO2Si/c1-29(2,3)34(27-13-7-4-8-14-27,28-15-9-5-10-16-28)33-24-20-30(17-11-6-12-18-30)19-21-31-22-25-32-26-23-31/h4-5,7-10,13-16H,6,11-12,17-26H2,1-3H3 |
| InChIKey | PBZDJMSRXSFVCU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.78 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|