C35H50O7Si — CID 174441455
3-[4-[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexyl]butoxycarbonyl]-4-ethoxy-4-oxobutanoic acid (PubChem CID 174441455) has the molecular formula C35H50O7Si and a molecular weight of 610.86 g/mol. Its IUPAC name is 3-[4-[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexyl]butoxycarbonyl]-4-ethoxy-4-oxobutanoic acid.
| Compound Name | 3-[4-[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexyl]butoxycarbonyl]-4-ethoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174441455 |
| Molecular Formula | C35H50O7Si |
| Molecular Weight | 610.86 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | 3-[4-[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexyl]butoxycarbonyl]-4-ethoxy-4-oxobutanoic acid |
| SMILES | CCOC(=O)C(CC(=O)O)C(=O)OCCCCC1(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C35H50O7Si/c1-5-40-32(38)30(27-31(36)37)33(39)41-25-16-15-23-35(21-13-8-14-22-35)24-26-42-43(34(2,3)4,28-17-9-6-10-18-28)29-19-11-7-12-20-29/h6-7,9-12,17-20,30H,5,8,13-16,21-27H2,1-4H3,(H,36,37) |
| InChIKey | OAOOUTHIIWFAGH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.86 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|