C27H36O2Si — CID 11091100
4-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-4-methylcyclopent-2-en-1-one (PubChem CID 11091100) has the molecular formula C27H36O2Si and a molecular weight of 420.67 g/mol. Its IUPAC name is 4-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-4-methylcyclopent-2-en-1-one.
| Compound Name | 4-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-4-methylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 11091100 |
| Molecular Formula | C27H36O2Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 4-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-4-methylcyclopent-2-en-1-one |
| SMILES | CC1(CCCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=CC(=O)C1 |
| InChI | InChI=1S/C27H36O2Si/c1-26(2,3)30(24-14-8-5-9-15-24,25-16-10-6-11-17-25)29-21-13-7-12-19-27(4)20-18-23(28)22-27/h5-6,8-11,14-18,20H,7,12-13,19,21-22H2,1-4H3 |
| InChIKey | IGUHMMBAHAUMPJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|